C17H19N3O3 — CID 121239710
4,7-dimethoxy-N-(2-pyrrol-1-ylethyl)-1H-indole-2-carboxamide (PubChem CID 121239710) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4,7-dimethoxy-N-(2-pyrrol-1-ylethyl)-1H-indole-2-carboxamide.
| Compound Name | 4,7-dimethoxy-N-(2-pyrrol-1-ylethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 121239710 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 4,7-dimethoxy-N-(2-pyrrol-1-ylethyl)-1H-indole-2-carboxamide |
| SMILES | COc1ccc(OC)c2[nH]c(C(=O)NCCn3cccc3)cc12 |
| InChI | InChI=1S/C17H19N3O3/c1-22-14-5-6-15(23-2)16-12(14)11-13(19-16)17(21)18-7-10-20-8-3-4-9-20/h3-6,8-9,11,19H,7,10H2,1-2H3,(H,18,21) |
| InChIKey | PJVIXKLLIQWEQK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |