C22H23N3O4 — CID 71825514
5,6-dimethoxy-N-[2-(4-methoxyindol-1-yl)ethyl]-1H-indole-2-carboxamide (PubChem CID 71825514) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 5,6-dimethoxy-N-[2-(4-methoxyindol-1-yl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5,6-dimethoxy-N-[2-(4-methoxyindol-1-yl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 71825514 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 5,6-dimethoxy-N-[2-(4-methoxyindol-1-yl)ethyl]-1H-indole-2-carboxamide |
| SMILES | COc1cc2cc(C(=O)NCCn3ccc4c(OC)cccc43)[nH]c2cc1OC |
| InChI | InChI=1S/C22H23N3O4/c1-27-19-6-4-5-18-15(19)7-9-25(18)10-8-23-22(26)17-11-14-12-20(28-2)21(29-3)13-16(14)24-17/h4-7,9,11-13,24H,8,10H2,1-3H3,(H,23,26) |
| InChIKey | LOSABDLWEOSTTE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |