C19H17F3N2O4 — CID 4975849
4,5,6-trimethoxy-N-[3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide (PubChem CID 4975849) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is 4,5,6-trimethoxy-N-[3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide.
| Compound Name | 4,5,6-trimethoxy-N-[3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 4975849 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 4,5,6-trimethoxy-N-[3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide |
| SMILES | COc1cc2[nH]c(C(=O)Nc3cccc(C(F)(F)F)c3)cc2c(OC)c1OC |
| InChI | InChI=1S/C19H17F3N2O4/c1-26-15-9-13-12(16(27-2)17(15)28-3)8-14(24-13)18(25)23-11-6-4-5-10(7-11)19(20,21)22/h4-9,24H,1-3H3,(H,23,25) |
| InChIKey | VFLMGQXWTHFZBW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |