C21H31N3O4 — CID 164547060
4,5,6-trimethoxy-N-(1-pentylpyrrolidin-3-yl)-1H-indole-2-carboxamide (PubChem CID 164547060) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4,5,6-trimethoxy-N-(1-pentylpyrrolidin-3-yl)-1H-indole-2-carboxamide.
| Compound Name | 4,5,6-trimethoxy-N-(1-pentylpyrrolidin-3-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 164547060 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 4,5,6-trimethoxy-N-(1-pentylpyrrolidin-3-yl)-1H-indole-2-carboxamide |
| SMILES | CCCCCN1CCC(NC(=O)c2cc3c(OC)c(OC)c(OC)cc3[nH]2)C1 |
| InChI | InChI=1S/C21H31N3O4/c1-5-6-7-9-24-10-8-14(13-24)22-21(25)17-11-15-16(23-17)12-18(26-2)20(28-4)19(15)27-3/h11-12,14,23H,5-10,13H2,1-4H3,(H,22,25) |
| InChIKey | LLLJQWKSXVNRHZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|