C18H29N3O3 — CID 119717821
3-[(2-amino-2-methylpentanoyl)amino]-N-(3-ethoxypropyl)benzamide (PubChem CID 119717821) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-[(2-amino-2-methylpentanoyl)amino]-N-(3-ethoxypropyl)benzamide.
| Compound Name | 3-[(2-amino-2-methylpentanoyl)amino]-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 119717821 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 3-[(2-amino-2-methylpentanoyl)amino]-N-(3-ethoxypropyl)benzamide |
| SMILES | CCCC(C)(N)C(=O)Nc1cccc(C(=O)NCCCOCC)c1 |
| InChI | InChI=1S/C18H29N3O3/c1-4-10-18(3,19)17(23)21-15-9-6-8-14(13-15)16(22)20-11-7-12-24-5-2/h6,8-9,13H,4-5,7,10-12,19H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | UYZPFLRLIAWRFX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|