C19H21IN2O3 — CID 55801744
N-(3-ethoxypropyl)-3-[(3-iodobenzoyl)amino]benzamide (PubChem CID 55801744) has the molecular formula C19H21IN2O3 and a molecular weight of 452.29 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3-[(3-iodobenzoyl)amino]benzamide.
| Compound Name | N-(3-ethoxypropyl)-3-[(3-iodobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 55801744 |
| Molecular Formula | C19H21IN2O3 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | N-(3-ethoxypropyl)-3-[(3-iodobenzoyl)amino]benzamide |
| SMILES | CCOCCCNC(=O)c1cccc(NC(=O)c2cccc(I)c2)c1 |
| InChI | InChI=1S/C19H21IN2O3/c1-2-25-11-5-10-21-18(23)15-7-4-9-17(13-15)22-19(24)14-6-3-8-16(20)12-14/h3-4,6-9,12-13H,2,5,10-11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | WSXKQRWMGBRNSV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|