C20H21N3O3S — CID 53030354
N-[3-(3-ethoxypropylcarbamoyl)phenyl]-1,2-benzothiazole-3-carboxamide (PubChem CID 53030354) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[3-(3-ethoxypropylcarbamoyl)phenyl]-1,2-benzothiazole-3-carboxamide.
| Compound Name | N-[3-(3-ethoxypropylcarbamoyl)phenyl]-1,2-benzothiazole-3-carboxamide |
|---|---|
| PubChem CID | 53030354 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[3-(3-ethoxypropylcarbamoyl)phenyl]-1,2-benzothiazole-3-carboxamide |
| SMILES | CCOCCCNC(=O)c1cccc(NC(=O)c2nsc3ccccc23)c1 |
| InChI | InChI=1S/C20H21N3O3S/c1-2-26-12-6-11-21-19(24)14-7-5-8-15(13-14)22-20(25)18-16-9-3-4-10-17(16)27-23-18/h3-5,7-10,13H,2,6,11-12H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | FWBGSNKKJINKSS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|