C18H20ClN3OS — CID 94494667
1-(2-chlorophenyl)-3-[(4-morpholin-4-ylphenyl)methyl]thiourea (PubChem CID 94494667) has the molecular formula C18H20ClN3OS and a molecular weight of 361.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(4-morpholin-4-ylphenyl)methyl]thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-[(4-morpholin-4-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 94494667 |
| Molecular Formula | C18H20ClN3OS |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(4-morpholin-4-ylphenyl)methyl]thiourea |
| SMILES | S=C(NCc1ccc(N2CCOCC2)cc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C18H20ClN3OS/c19-16-3-1-2-4-17(16)21-18(24)20-13-14-5-7-15(8-6-14)22-9-11-23-12-10-22/h1-8H,9-13H2,(H2,20,21,24) |
| InChIKey | ZJSJAZACEMLTPU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|