C26H31N3O4 — CID 112761780
2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2,4-dimorpholin-4-ylphenyl)acetamide (PubChem CID 112761780) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2,4-dimorpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2,4-dimorpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 112761780 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2,4-dimorpholin-4-ylphenyl)acetamide |
| SMILES | Cc1ccc2c(CC(=O)Nc3ccc(N4CCOCC4)cc3N3CCOCC3)coc2c1C |
| InChI | InChI=1S/C26H31N3O4/c1-18-3-5-22-20(17-33-26(22)19(18)2)15-25(30)27-23-6-4-21(28-7-11-31-12-8-28)16-24(23)29-9-13-32-14-10-29/h3-6,16-17H,7-15H2,1-2H3,(H,27,30) |
| InChIKey | ZGGAGPNARKSIOP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |