C20H23ClN4O5S — CID 166330937
3-chloro-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-4-sulfamoylbenzamide (PubChem CID 166330937) has the molecular formula C20H23ClN4O5S and a molecular weight of 466.95 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-4-sulfamoylbenzamide.
| Compound Name | 3-chloro-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 166330937 |
| Molecular Formula | C20H23ClN4O5S |
| Molecular Weight | 466.95 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 3-chloro-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-4-sulfamoylbenzamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)C(=O)c1ccc(S(N)(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C20H23ClN4O5S/c1-24(20(27)14-2-7-18(17(21)12-14)31(22,28)29)13-19(26)23-15-3-5-16(6-4-15)25-8-10-30-11-9-25/h2-7,12H,8-11,13H2,1H3,(H,23,26)(H2,22,28,29) |
| InChIKey | FNQWWDVHCYFZQF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.95 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|