C23H30N4O6S — CID 55754799
N,5-dimethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide (PubChem CID 55754799) has the molecular formula C23H30N4O6S and a molecular weight of 490.58 g/mol. Its IUPAC name is N,5-dimethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide.
| Compound Name | N,5-dimethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55754799 |
| Molecular Formula | C23H30N4O6S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N,5-dimethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide |
| SMILES | Cc1oc(C(=O)N(C)CC(=O)Nc2ccc(N3CCOCC3)cc2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C23H30N4O6S/c1-17-21(34(30,31)27-9-3-4-10-27)15-20(33-17)23(29)25(2)16-22(28)24-18-5-7-19(8-6-18)26-11-13-32-14-12-26/h5-8,15H,3-4,9-14,16H2,1-2H3,(H,24,28) |
| InChIKey | JMNGPMSMCHYJMK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|