C14H22N2O2 — CID 55234148
2-ethoxy-4-(3-ethylmorpholin-4-yl)aniline (PubChem CID 55234148) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-ethoxy-4-(3-ethylmorpholin-4-yl)aniline.
| Compound Name | 2-ethoxy-4-(3-ethylmorpholin-4-yl)aniline |
|---|---|
| PubChem CID | 55234148 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-ethoxy-4-(3-ethylmorpholin-4-yl)aniline |
| SMILES | CCOc1cc(N2CCOCC2CC)ccc1N |
| InChI | InChI=1S/C14H22N2O2/c1-3-11-10-17-8-7-16(11)12-5-6-13(15)14(9-12)18-4-2/h5-6,9,11H,3-4,7-8,10,15H2,1-2H3 |
| InChIKey | FURWRRIPNOSUGM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|