C21H19FN4O4 — CID 123941958
2-fluoro-5-[[5-(3-morpholin-4-ylphenoxy)pyrimidin-2-yl]amino]benzoic acid (PubChem CID 123941958) has the molecular formula C21H19FN4O4 and a molecular weight of 410.41 g/mol. Its IUPAC name is 2-fluoro-5-[[5-(3-morpholin-4-ylphenoxy)pyrimidin-2-yl]amino]benzoic acid.
| Compound Name | 2-fluoro-5-[[5-(3-morpholin-4-ylphenoxy)pyrimidin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 123941958 |
| Molecular Formula | C21H19FN4O4 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-fluoro-5-[[5-(3-morpholin-4-ylphenoxy)pyrimidin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1cc(Nc2ncc(Oc3cccc(N4CCOCC4)c3)cn2)ccc1F |
| InChI | InChI=1S/C21H19FN4O4/c22-19-5-4-14(10-18(19)20(27)28)25-21-23-12-17(13-24-21)30-16-3-1-2-15(11-16)26-6-8-29-9-7-26/h1-5,10-13H,6-9H2,(H,27,28)(H,23,24,25) |
| InChIKey | QSGWTCFXIOTRAH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |