C24H31ClN2O4 — CID 153326926
methyl (E)-2-[2-[[5-chloro-4-methyl-1-[(4-methylcyclohexyl)methyl]pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 153326926) has the molecular formula C24H31ClN2O4 and a molecular weight of 446.98 g/mol. Its IUPAC name is methyl (E)-2-[2-[[5-chloro-4-methyl-1-[(4-methylcyclohexyl)methyl]pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[5-chloro-4-methyl-1-[(4-methylcyclohexyl)methyl]pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 153326926 |
| Molecular Formula | C24H31ClN2O4 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | methyl (E)-2-[2-[[5-chloro-4-methyl-1-[(4-methylcyclohexyl)methyl]pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1nn(CC2CCC(C)CC2)c(Cl)c1C |
| InChI | InChI=1S/C24H31ClN2O4/c1-16-9-11-18(12-10-16)13-27-22(25)17(2)23(26-27)31-14-19-7-5-6-8-20(19)21(15-29-3)24(28)30-4/h5-8,15-16,18H,9-14H2,1-4H3/b21-15+ |
| InChIKey | VHRCLRMVZSBCOD-RCCKNPSSSA-N |
| XLogP | 5.41 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|