C23H28Cl2N2O6 — CID 87774025
(2E)-2-[2-[[3,5-dichloro-4-[2-(2-ethoxyethoxy)ethoxy]phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 87774025) has the molecular formula C23H28Cl2N2O6 and a molecular weight of 499.39 g/mol. Its IUPAC name is (2E)-2-[2-[[3,5-dichloro-4-[2-(2-ethoxyethoxy)ethoxy]phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | (2E)-2-[2-[[3,5-dichloro-4-[2-(2-ethoxyethoxy)ethoxy]phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 87774025 |
| Molecular Formula | C23H28Cl2N2O6 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | (2E)-2-[2-[[3,5-dichloro-4-[2-(2-ethoxyethoxy)ethoxy]phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CCOCCOCCOc1c(Cl)cc(OCc2ccccc2/C(=N\OC)C(=O)NC)cc1Cl |
| InChI | InChI=1S/C23H28Cl2N2O6/c1-4-30-9-10-31-11-12-32-22-19(24)13-17(14-20(22)25)33-15-16-7-5-6-8-18(16)21(27-29-3)23(28)26-2/h5-8,13-14H,4,9-12,15H2,1-3H3,(H,26,28)/b27-21+ |
| InChIKey | SFYSOXZBBOTTQS-SZXQPVLSSA-N |
| XLogP | 4.10 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|