C23H26N4O4 — CID 131721065
pentyl (2Z)-2-methoxyimino-2-[2-[(1-phenyl-1,2,4-triazol-3-yl)oxymethyl]phenyl]acetate (PubChem CID 131721065) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is pentyl (2Z)-2-methoxyimino-2-[2-[(1-phenyl-1,2,4-triazol-3-yl)oxymethyl]phenyl]acetate.
| Compound Name | pentyl (2Z)-2-methoxyimino-2-[2-[(1-phenyl-1,2,4-triazol-3-yl)oxymethyl]phenyl]acetate |
|---|---|
| PubChem CID | 131721065 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | pentyl (2Z)-2-methoxyimino-2-[2-[(1-phenyl-1,2,4-triazol-3-yl)oxymethyl]phenyl]acetate |
| SMILES | CCCCCOC(=O)/C(=N\OC)c1ccccc1COc1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H26N4O4/c1-3-4-10-15-30-22(28)21(26-29-2)20-14-9-8-11-18(20)16-31-23-24-17-27(25-23)19-12-6-5-7-13-19/h5-9,11-14,17H,3-4,10,15-16H2,1-2H3/b26-21- |
| InChIKey | WAGWVDUFJDMYPC-QLYXXIJNSA-N |
| XLogP | 3.93 |
| TPSA | 87.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|