C25H26O6 — CID 88920017
(E)-2-[2-[(3-butyl-4-methyl-2-oxochromen-7-yl)oxymethyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 88920017) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is (E)-2-[2-[(3-butyl-4-methyl-2-oxochromen-7-yl)oxymethyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-2-[2-[(3-butyl-4-methyl-2-oxochromen-7-yl)oxymethyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 88920017 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (E)-2-[2-[(3-butyl-4-methyl-2-oxochromen-7-yl)oxymethyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CCCCc1c(C)c2ccc(OCc3ccccc3/C(=C\OC)C(=O)O)cc2oc1=O |
| InChI | InChI=1S/C25H26O6/c1-4-5-9-20-16(2)19-12-11-18(13-23(19)31-25(20)28)30-14-17-8-6-7-10-21(17)22(15-29-3)24(26)27/h6-8,10-13,15H,4-5,9,14H2,1-3H3,(H,26,27)/b22-15+ |
| InChIKey | RYDIBPOWUGPYTK-PXLXIMEGSA-N |
| XLogP | 5.09 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|