C16H17NO4S — CID 67827424
(E)-2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 67827424) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is (E)-2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 67827424 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (E)-2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C=C(/C(=O)O)c1ccccc1SCc1c(C)noc1C |
| InChI | InChI=1S/C16H17NO4S/c1-10-14(11(2)21-17-10)9-22-15-7-5-4-6-12(15)13(8-20-3)16(18)19/h4-8H,9H2,1-3H3,(H,18,19)/b13-8+ |
| InChIKey | FEXXOLOAIOYARQ-MDWZMJQESA-N |
| XLogP | 3.66 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|