C18H18N4O3S — CID 78814232
N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzoyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 78814232) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzoyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzoyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78814232 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzoyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | Cc1noc(C)c1CSc1ccccc1C(=O)NNC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C18H18N4O3S/c1-11-14(12(2)25-22-11)10-26-16-8-4-3-6-13(16)17(23)20-21-18(24)15-7-5-9-19-15/h3-9,19H,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | NEGGTVFQGRCZGH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|