C18H21N3O4S — CID 39480889
(2R)-N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzoyl]oxolane-2-carbohydrazide (PubChem CID 39480889) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is (2R)-N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzoyl]oxolane-2-carbohydrazide.
| Compound Name | (2R)-N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzoyl]oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 39480889 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (2R)-N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzoyl]oxolane-2-carbohydrazide |
| SMILES | Cc1noc(C)c1CSc1ccccc1C(=O)NNC(=O)[C@H]1CCCO1 |
| InChI | InChI=1S/C18H21N3O4S/c1-11-14(12(2)25-21-11)10-26-16-8-4-3-6-13(16)17(22)19-20-18(23)15-7-5-9-24-15/h3-4,6,8,15H,5,7,9-10H2,1-2H3,(H,19,22)(H,20,23)/t15-/m1/s1 |
| InChIKey | ZFNNBPSFIHNZHE-OAHLLOKOSA-N |
| XLogP | 2.52 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|