C23H30N2O2S — CID 18532839
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide (PubChem CID 18532839) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide |
|---|---|
| PubChem CID | 18532839 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide |
| SMILES | Cc1noc(C)c1CSc1ccccc1C(=O)N[C@H]1C[C@@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C23H30N2O2S/c1-14-18(15(2)27-25-14)13-28-19-9-7-6-8-17(19)21(26)24-20-12-16-10-11-23(20,5)22(16,3)4/h6-9,16,20H,10-13H2,1-5H3,(H,24,26)/t16-,20-,23-/m0/s1 |
| InChIKey | FXVOSWNKQHJNJC-GRWTVWFQSA-N |
| XLogP | 5.53 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |