C22H29N3O3S — CID 55806159
N-[2-(cyclohexanecarbonylamino)ethyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzamide (PubChem CID 55806159) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[2-(cyclohexanecarbonylamino)ethyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzamide.
| Compound Name | N-[2-(cyclohexanecarbonylamino)ethyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 55806159 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[2-(cyclohexanecarbonylamino)ethyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzamide |
| SMILES | Cc1noc(C)c1CSc1ccccc1C(=O)NCCNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C22H29N3O3S/c1-15-19(16(2)28-25-15)14-29-20-11-7-6-10-18(20)22(27)24-13-12-23-21(26)17-8-4-3-5-9-17/h6-7,10-11,17H,3-5,8-9,12-14H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | QDOQXYWDRHMBTE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|