C21H23N5O4S2 — CID 46550494
N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzoyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 46550494) has the molecular formula C21H23N5O4S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzoyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzoyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46550494 |
| Molecular Formula | C21H23N5O4S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]benzoyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1noc(C)c1CSc1ccccc1C(=O)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H23N5O4S2/c1-13-16(14(2)30-25-13)11-31-18-6-4-3-5-15(18)19(27)23-24-20(28)17-12-32-21(22-17)26-7-9-29-10-8-26/h3-6,12H,7-11H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | HOWSPEQCOCWZLX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|