C20H17ClO3 — CID 173240825
(E)-2-[2-[(3E)-4-(4-chlorophenyl)buta-1,3-dienyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 173240825) has the molecular formula C20H17ClO3 and a molecular weight of 340.81 g/mol. Its IUPAC name is (E)-2-[2-[(3E)-4-(4-chlorophenyl)buta-1,3-dienyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-2-[2-[(3E)-4-(4-chlorophenyl)buta-1,3-dienyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 173240825 |
| Molecular Formula | C20H17ClO3 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (E)-2-[2-[(3E)-4-(4-chlorophenyl)buta-1,3-dienyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C=C(/C(=O)O)c1ccccc1C=C/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClO3/c1-24-14-19(20(22)23)18-9-5-4-8-16(18)7-3-2-6-15-10-12-17(21)13-11-15/h2-14H,1H3,(H,22,23)/b6-2+,7-3?,19-14+ |
| InChIKey | AEJZGWMKMUWLTN-LZJGRKDDSA-N |
| XLogP | 5.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|