C19H19ClO4S — CID 67787238
(E)-2-[2-[(4-chloro-3-methoxyphenyl)methylsulfanyl]-3-methylphenyl]-3-methoxyprop-2-enoic acid (PubChem CID 67787238) has the molecular formula C19H19ClO4S and a molecular weight of 378.88 g/mol. Its IUPAC name is (E)-2-[2-[(4-chloro-3-methoxyphenyl)methylsulfanyl]-3-methylphenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-2-[2-[(4-chloro-3-methoxyphenyl)methylsulfanyl]-3-methylphenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 67787238 |
| Molecular Formula | C19H19ClO4S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (E)-2-[2-[(4-chloro-3-methoxyphenyl)methylsulfanyl]-3-methylphenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C=C(/C(=O)O)c1cccc(C)c1SCc1ccc(Cl)c(OC)c1 |
| InChI | InChI=1S/C19H19ClO4S/c1-12-5-4-6-14(15(10-23-2)19(21)22)18(12)25-11-13-7-8-16(20)17(9-13)24-3/h4-10H,11H2,1-3H3,(H,21,22)/b15-10+ |
| InChIKey | ZARCVBAKGDHYFS-XNTDXEJSSA-N |
| XLogP | 5.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|