C18H17ClO3S — CID 67787691
2-[3-chloro-2-[(2,5-dimethylphenyl)methylsulfanyl]phenyl]-3-hydroxyprop-2-enoic acid (PubChem CID 67787691) has the molecular formula C18H17ClO3S and a molecular weight of 348.85 g/mol. Its IUPAC name is 2-[3-chloro-2-[(2,5-dimethylphenyl)methylsulfanyl]phenyl]-3-hydroxyprop-2-enoic acid.
| Compound Name | 2-[3-chloro-2-[(2,5-dimethylphenyl)methylsulfanyl]phenyl]-3-hydroxyprop-2-enoic acid |
|---|---|
| PubChem CID | 67787691 |
| Molecular Formula | C18H17ClO3S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-[3-chloro-2-[(2,5-dimethylphenyl)methylsulfanyl]phenyl]-3-hydroxyprop-2-enoic acid |
| SMILES | Cc1ccc(C)c(CSc2c(Cl)cccc2C(=CO)C(=O)O)c1 |
| InChI | InChI=1S/C18H17ClO3S/c1-11-6-7-12(2)13(8-11)10-23-17-14(4-3-5-16(17)19)15(9-20)18(21)22/h3-9,20H,10H2,1-2H3,(H,21,22) |
| InChIKey | LWBZQYSPVXLWKL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|