C20H17FN4O4S — CID 141254802
N-[[4-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]carbamothioyl]-4-fluorobenzamide (PubChem CID 141254802) has the molecular formula C20H17FN4O4S and a molecular weight of 428.45 g/mol. Its IUPAC name is N-[[4-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]carbamothioyl]-4-fluorobenzamide.
| Compound Name | N-[[4-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]carbamothioyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 141254802 |
| Molecular Formula | C20H17FN4O4S |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[[4-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]carbamothioyl]-4-fluorobenzamide |
| SMILES | COc1cc(OC)nc(Oc2ccc(NC(=S)NC(=O)c3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C20H17FN4O4S/c1-27-16-11-17(28-2)24-19(23-16)29-15-9-7-14(8-10-15)22-20(30)25-18(26)12-3-5-13(21)6-4-12/h3-11H,1-2H3,(H2,22,25,26,30) |
| InChIKey | SVOFSJWJFKGOIK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|