C16H20N4O2S — CID 141426269
4,6-dimethoxy-2-(2-piperazin-1-ylphenyl)sulfanylpyrimidine (PubChem CID 141426269) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 4,6-dimethoxy-2-(2-piperazin-1-ylphenyl)sulfanylpyrimidine.
| Compound Name | 4,6-dimethoxy-2-(2-piperazin-1-ylphenyl)sulfanylpyrimidine |
|---|---|
| PubChem CID | 141426269 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 4,6-dimethoxy-2-(2-piperazin-1-ylphenyl)sulfanylpyrimidine |
| SMILES | COc1cc(OC)nc(Sc2ccccc2N2CCNCC2)n1 |
| InChI | InChI=1S/C16H20N4O2S/c1-21-14-11-15(22-2)19-16(18-14)23-13-6-4-3-5-12(13)20-9-7-17-8-10-20/h3-6,11,17H,7-10H2,1-2H3 |
| InChIKey | KQJWMRYDHRQARZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |