C17H14N2O3S — CID 142661885
7-(4,6-dimethoxypyrimidin-2-yl)sulfanylnaphthalene-1-carbaldehyde (PubChem CID 142661885) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is 7-(4,6-dimethoxypyrimidin-2-yl)sulfanylnaphthalene-1-carbaldehyde.
| Compound Name | 7-(4,6-dimethoxypyrimidin-2-yl)sulfanylnaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 142661885 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 7-(4,6-dimethoxypyrimidin-2-yl)sulfanylnaphthalene-1-carbaldehyde |
| SMILES | COc1cc(OC)nc(Sc2ccc3cccc(C=O)c3c2)n1 |
| InChI | InChI=1S/C17H14N2O3S/c1-21-15-9-16(22-2)19-17(18-15)23-13-7-6-11-4-3-5-12(10-20)14(11)8-13/h3-10H,1-2H3 |
| InChIKey | JYHSOAZVGBMMTJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|