C15H18Cl2N2O3 — CID 129431700
2-[(3,4-dichlorophenyl)methylideneamino]oxy-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]ethanone (PubChem CID 129431700) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylideneamino]oxy-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]ethanone.
| Compound Name | 2-[(3,4-dichlorophenyl)methylideneamino]oxy-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 129431700 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylideneamino]oxy-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]ethanone |
| SMILES | C[C@@H]1CN(C(=O)CON=Cc2ccc(Cl)c(Cl)c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C15H18Cl2N2O3/c1-10-7-19(8-11(2)22-10)15(20)9-21-18-6-12-3-4-13(16)14(17)5-12/h3-6,10-11H,7-9H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | LSMKVBMNINCJND-GHMZBOCLSA-N |
| XLogP | 2.98 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|