C15H9BrCl2O3 — CID 132593294
(Z)-2-(4-bromophenoxy)-3-(3,4-dichlorophenyl)prop-2-enoic acid (PubChem CID 132593294) has the molecular formula C15H9BrCl2O3 and a molecular weight of 388.04 g/mol. Its IUPAC name is (Z)-2-(4-bromophenoxy)-3-(3,4-dichlorophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(4-bromophenoxy)-3-(3,4-dichlorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 132593294 |
| Molecular Formula | C15H9BrCl2O3 |
| Molecular Weight | 388.04 g/mol |
| Exact Mass | 385.91 |
| IUPAC Name | (Z)-2-(4-bromophenoxy)-3-(3,4-dichlorophenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1ccc(Cl)c(Cl)c1)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H9BrCl2O3/c16-10-2-4-11(5-3-10)21-14(15(19)20)8-9-1-6-12(17)13(18)7-9/h1-8H,(H,19,20)/b14-8- |
| InChIKey | HCFUJRNXFNQUAC-ZSOIEALJSA-N |
| XLogP | 5.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.04 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|