C23H18BrCl2NO2 — CID 3696314
3-[4-[(4-bromophenyl)methoxy]phenyl]-N-[(3,4-dichlorophenyl)methyl]prop-2-enamide (PubChem CID 3696314) has the molecular formula C23H18BrCl2NO2 and a molecular weight of 491.21 g/mol. Its IUPAC name is 3-[4-[(4-bromophenyl)methoxy]phenyl]-N-[(3,4-dichlorophenyl)methyl]prop-2-enamide.
| Compound Name | 3-[4-[(4-bromophenyl)methoxy]phenyl]-N-[(3,4-dichlorophenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 3696314 |
| Molecular Formula | C23H18BrCl2NO2 |
| Molecular Weight | 491.21 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | 3-[4-[(4-bromophenyl)methoxy]phenyl]-N-[(3,4-dichlorophenyl)methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(OCc2ccc(Br)cc2)cc1)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H18BrCl2NO2/c24-19-7-1-17(2-8-19)15-29-20-9-3-16(4-10-20)6-12-23(28)27-14-18-5-11-21(25)22(26)13-18/h1-13H,14-15H2,(H,27,28) |
| InChIKey | RHIRRTAPLAZVLO-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.21 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|