C19H18Cl2FNO2 — CID 5129558
N-[(3,4-dichlorophenyl)methyl]-3-[4-(3-fluoropropoxy)phenyl]prop-2-enamide (PubChem CID 5129558) has the molecular formula C19H18Cl2FNO2 and a molecular weight of 382.26 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-3-[4-(3-fluoropropoxy)phenyl]prop-2-enamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-3-[4-(3-fluoropropoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 5129558 |
| Molecular Formula | C19H18Cl2FNO2 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-3-[4-(3-fluoropropoxy)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(OCCCF)cc1)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl2FNO2/c20-17-8-4-15(12-18(17)21)13-23-19(24)9-5-14-2-6-16(7-3-14)25-11-1-10-22/h2-9,12H,1,10-11,13H2,(H,23,24) |
| InChIKey | WDNKTQFPWGJRGF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|