C21H18BrNO2S — CID 1472309
3-[4-[(4-bromophenyl)methoxy]phenyl]-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 1472309) has the molecular formula C21H18BrNO2S and a molecular weight of 428.35 g/mol. Its IUPAC name is 3-[4-[(4-bromophenyl)methoxy]phenyl]-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | 3-[4-[(4-bromophenyl)methoxy]phenyl]-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 1472309 |
| Molecular Formula | C21H18BrNO2S |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 3-[4-[(4-bromophenyl)methoxy]phenyl]-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(OCc2ccc(Br)cc2)cc1)NCc1cccs1 |
| InChI | InChI=1S/C21H18BrNO2S/c22-18-8-3-17(4-9-18)15-25-19-10-5-16(6-11-19)7-12-21(24)23-14-20-2-1-13-26-20/h1-13H,14-15H2,(H,23,24) |
| InChIKey | RGGUXTAIIQPDLL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|