C22H17BrN2O4 — CID 51057666
(E)-3-[4-[(4-bromophenyl)methoxy]phenyl]-N-(2-nitrophenyl)prop-2-enamide (PubChem CID 51057666) has the molecular formula C22H17BrN2O4 and a molecular weight of 453.29 g/mol. Its IUPAC name is (E)-3-[4-[(4-bromophenyl)methoxy]phenyl]-N-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-[(4-bromophenyl)methoxy]phenyl]-N-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 51057666 |
| Molecular Formula | C22H17BrN2O4 |
| Molecular Weight | 453.29 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | (E)-3-[4-[(4-bromophenyl)methoxy]phenyl]-N-(2-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OCc2ccc(Br)cc2)cc1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17BrN2O4/c23-18-10-5-17(6-11-18)15-29-19-12-7-16(8-13-19)9-14-22(26)24-20-3-1-2-4-21(20)25(27)28/h1-14H,15H2,(H,24,26)/b14-9+ |
| InChIKey | ITCHCRFTLYUBLY-NTEUORMPSA-N |
| XLogP | 5.59 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.29 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|