C26H27N3O6 — CID 66893186
(Z)-N-(2-nitrophenyl)-3-[4-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenyl]prop-2-enamide (PubChem CID 66893186) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is (Z)-N-(2-nitrophenyl)-3-[4-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenyl]prop-2-enamide.
| Compound Name | (Z)-N-(2-nitrophenyl)-3-[4-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 66893186 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | (Z)-N-(2-nitrophenyl)-3-[4-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(CNCc2ccc(/C=C\C(=O)Nc3ccccc3[N+](=O)[O-])cc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H27N3O6/c1-33-23-14-20(15-24(34-2)26(23)35-3)17-27-16-19-10-8-18(9-11-19)12-13-25(30)28-21-6-4-5-7-22(21)29(31)32/h4-15,27H,16-17H2,1-3H3,(H,28,30)/b13-12- |
| InChIKey | PRHGSTVTQAATGK-SEYXRHQNSA-N |
| XLogP | 4.56 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|