C9H6Cl2O2 — CID 51372688
(E)-2-(3,4-dichlorophenyl)-3-hydroxyprop-2-enal (PubChem CID 51372688) has the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. Its IUPAC name is (E)-2-(3,4-dichlorophenyl)-3-hydroxyprop-2-enal.
| Compound Name | (E)-2-(3,4-dichlorophenyl)-3-hydroxyprop-2-enal |
|---|---|
| PubChem CID | 51372688 |
| Molecular Formula | C9H6Cl2O2 |
| Molecular Weight | 217.05 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | (E)-2-(3,4-dichlorophenyl)-3-hydroxyprop-2-enal |
| SMILES | O=C/C(=C/O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H6Cl2O2/c10-8-2-1-6(3-9(8)11)7(4-12)5-13/h1-5,12H/b7-4- |
| InChIKey | KKGNSPZVQGSOAL-DAXSKMNVSA-N |
| XLogP | 3.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.05 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|