C9H9Cl2NO2 — CID 124638959
(E,3S)-3-amino-2-(3,4-dichlorophenyl)prop-1-ene-1,3-diol (PubChem CID 124638959) has the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. Its IUPAC name is (E,3S)-3-amino-2-(3,4-dichlorophenyl)prop-1-ene-1,3-diol.
| Compound Name | (E,3S)-3-amino-2-(3,4-dichlorophenyl)prop-1-ene-1,3-diol |
|---|---|
| PubChem CID | 124638959 |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | (E,3S)-3-amino-2-(3,4-dichlorophenyl)prop-1-ene-1,3-diol |
| SMILES | N[C@@H](O)/C(=C/O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2NO2/c10-7-2-1-5(3-8(7)11)6(4-13)9(12)14/h1-4,9,13-14H,12H2/b6-4+/t9-/m0/s1 |
| InChIKey | BKVICNVSOPPISE-DNQSNQRASA-N |
| XLogP | 2.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|