C12H13Cl2NO3 — CID 91151521
5-(3,4-dichlorophenyl)-5-(methoxyamino)pent-4-enoic acid (PubChem CID 91151521) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-5-(methoxyamino)pent-4-enoic acid.
| Compound Name | 5-(3,4-dichlorophenyl)-5-(methoxyamino)pent-4-enoic acid |
|---|---|
| PubChem CID | 91151521 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-5-(methoxyamino)pent-4-enoic acid |
| SMILES | CONC(=CCCC(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO3/c1-18-15-11(3-2-4-12(16)17)8-5-6-9(13)10(14)7-8/h3,5-7,15H,2,4H2,1H3,(H,16,17) |
| InChIKey | SVGXLIITBKSYKQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|