C12H14Cl2N2O2 — CID 90976881
5-(3,4-dichlorophenyl)-5-(methoxyamino)pent-4-enamide (PubChem CID 90976881) has the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.16 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-5-(methoxyamino)pent-4-enamide.
| Compound Name | 5-(3,4-dichlorophenyl)-5-(methoxyamino)pent-4-enamide |
|---|---|
| PubChem CID | 90976881 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-5-(methoxyamino)pent-4-enamide |
| SMILES | CONC(=CCCC(N)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O2/c1-18-16-11(3-2-4-12(15)17)8-5-6-9(13)10(14)7-8/h3,5-7,16H,2,4H2,1H3,(H2,15,17) |
| InChIKey | VFVDHFKGTXRJSF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|