C12H16Cl2N2O2S — CID 157235630
N-[(2S)-5-amino-5-oxopentan-2-yl]-3,4-dichlorobenzamide;sulfane (PubChem CID 157235630) has the molecular formula C12H16Cl2N2O2S and a molecular weight of 323.25 g/mol. Its IUPAC name is N-[(2S)-5-amino-5-oxopentan-2-yl]-3,4-dichlorobenzamide;sulfane.
| Compound Name | N-[(2S)-5-amino-5-oxopentan-2-yl]-3,4-dichlorobenzamide;sulfane |
|---|---|
| PubChem CID | 157235630 |
| Molecular Formula | C12H16Cl2N2O2S |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | N-[(2S)-5-amino-5-oxopentan-2-yl]-3,4-dichlorobenzamide;sulfane |
| SMILES | C[C@@H](CCC(N)=O)NC(=O)c1ccc(Cl)c(Cl)c1.S |
| InChI | InChI=1S/C12H14Cl2N2O2.H2S/c1-7(2-5-11(15)17)16-12(18)8-3-4-9(13)10(14)6-8;/h3-4,6-7H,2,5H2,1H3,(H2,15,17)(H,16,18);1H2/t7-;/m0./s1 |
| InChIKey | AUPGZKWDQZKNEB-FJXQXJEOSA-N |
| XLogP | 2.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |