C13H20Cl2N2OS — CID 158295050
N-[(2S)-6-aminohexan-2-yl]-3,4-dichlorobenzamide;sulfane (PubChem CID 158295050) has the molecular formula C13H20Cl2N2OS and a molecular weight of 323.29 g/mol. Its IUPAC name is N-[(2S)-6-aminohexan-2-yl]-3,4-dichlorobenzamide;sulfane.
| Compound Name | N-[(2S)-6-aminohexan-2-yl]-3,4-dichlorobenzamide;sulfane |
|---|---|
| PubChem CID | 158295050 |
| Molecular Formula | C13H20Cl2N2OS |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-[(2S)-6-aminohexan-2-yl]-3,4-dichlorobenzamide;sulfane |
| SMILES | C[C@@H](CCCCN)NC(=O)c1ccc(Cl)c(Cl)c1.S |
| InChI | InChI=1S/C13H18Cl2N2O.H2S/c1-9(4-2-3-7-16)17-13(18)10-5-6-11(14)12(15)8-10;/h5-6,8-9H,2-4,7,16H2,1H3,(H,17,18);1H2/t9-;/m0./s1 |
| InChIKey | GLURTVTVTVCPRE-FVGYRXGTSA-N |
| XLogP | 3.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|