C14H13Cl2N3O3 — CID 91400354
4-(3,4-dichlorophenyl)-4-(methoxyamino)-N-(1,2-oxazol-3-yl)but-3-enamide (PubChem CID 91400354) has the molecular formula C14H13Cl2N3O3 and a molecular weight of 342.18 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-4-(methoxyamino)-N-(1,2-oxazol-3-yl)but-3-enamide.
| Compound Name | 4-(3,4-dichlorophenyl)-4-(methoxyamino)-N-(1,2-oxazol-3-yl)but-3-enamide |
|---|---|
| PubChem CID | 91400354 |
| Molecular Formula | C14H13Cl2N3O3 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-4-(methoxyamino)-N-(1,2-oxazol-3-yl)but-3-enamide |
| SMILES | CONC(=CCC(=O)Nc1ccon1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2N3O3/c1-21-18-12(9-2-3-10(15)11(16)8-9)4-5-14(20)17-13-6-7-22-19-13/h2-4,6-8,18H,5H2,1H3,(H,17,19,20) |
| InChIKey | SKRBHNDNVJFWNZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|