C13H10N2O5 — CID 16595646
[2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 4-formylbenzoate (PubChem CID 16595646) has the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 16595646 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCC(=O)Nc2ccon2)cc1 |
| InChI | InChI=1S/C13H10N2O5/c16-7-9-1-3-10(4-2-9)13(18)19-8-12(17)14-11-5-6-20-15-11/h1-7H,8H2,(H,14,15,17) |
| InChIKey | WYNSDHJUZZOYHN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|