About [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate
[2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate (PubChem CID 2427225) has the molecular formula C20H15NO4
and a molecular weight of 333.34 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate.
Molecular Properties
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate |
| PubChem CID | 2427225 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCC(=O)Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C20H15NO4/c22-12-14-8-10-16(11-9-14)20(24)25-13-19(23)21-18-7-3-5-15-4-1-2-6-17(15)18/h1-12H,13H2,(H,21,23) |
| InChIKey | GTYACJJQPPUPSJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate?
The IUPAC name of [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate (CID 2427225) is [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate.
What is the SMILES notation for [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate?
The canonical SMILES for [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate is O=Cc1ccc(C(=O)OCC(=O)Nc2cccc3ccccc23)cc1.
What is the InChIKey of [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate?
The InChIKey is GTYACJJQPPUPSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO4/c22-12-14-8-10-16(11-9-14)20(24)25-13-19(23)21-18-7-3-5-15-4-1-2-6-17(15)18/h1-12H,13H2,(H,21,23).
What are the key properties of [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate?
[2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate has a molecular weight of 333.34 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-formylbenzoate is sourced from PubChem (CID 2427225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).