C23H24N2O5S — CID 2557649
[2-(naphthalen-1-ylamino)-2-oxoethyl] 4-(diethylsulfamoyl)benzoate (PubChem CID 2557649) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-(diethylsulfamoyl)benzoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2557649 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C23H24N2O5S/c1-3-25(4-2)31(28,29)19-14-12-18(13-15-19)23(27)30-16-22(26)24-21-11-7-9-17-8-5-6-10-20(17)21/h5-15H,3-4,16H2,1-2H3,(H,24,26) |
| InChIKey | ZXLOITICAGVPEG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |