C10H10Cl2N2O3 — CID 91024245
1-(3,4-dichlorophenyl)-N-methoxy-3-nitroprop-1-en-1-amine (PubChem CID 91024245) has the molecular formula C10H10Cl2N2O3 and a molecular weight of 277.11 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-methoxy-3-nitroprop-1-en-1-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-methoxy-3-nitroprop-1-en-1-amine |
|---|---|
| PubChem CID | 91024245 |
| Molecular Formula | C10H10Cl2N2O3 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-methoxy-3-nitroprop-1-en-1-amine |
| SMILES | CONC(=CC[N+](=O)[O-])c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2N2O3/c1-17-13-10(4-5-14(15)16)7-2-3-8(11)9(12)6-7/h2-4,6,13H,5H2,1H3 |
| InChIKey | IPSWQXONZUJKFY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|