C15H15Cl2NO3 — CID 163425201
3-[2-(3,4-dichlorophenyl)-2-oxoethyl]-N-methoxybicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 163425201) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.19 g/mol. Its IUPAC name is 3-[2-(3,4-dichlorophenyl)-2-oxoethyl]-N-methoxybicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | 3-[2-(3,4-dichlorophenyl)-2-oxoethyl]-N-methoxybicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 163425201 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 3-[2-(3,4-dichlorophenyl)-2-oxoethyl]-N-methoxybicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | CONC(=O)C12CC(CC(=O)c3ccc(Cl)c(Cl)c3)(C1)C2 |
| InChI | InChI=1S/C15H15Cl2NO3/c1-21-18-13(20)15-6-14(7-15,8-15)5-12(19)9-2-3-10(16)11(17)4-9/h2-4H,5-8H2,1H3,(H,18,20) |
| InChIKey | UBJXLDPZGFWTOT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|