C16H15F3N2O4S — CID 1013172
N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 1013172) has the molecular formula C16H15F3N2O4S and a molecular weight of 388.37 g/mol. Its IUPAC name is N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 1013172 |
| Molecular Formula | C16H15F3N2O4S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H15F3N2O4S/c1-2-25-13-7-3-12(4-8-13)21-26(23,24)14-9-5-11(6-10-14)20-15(22)16(17,18)19/h3-10,21H,2H2,1H3,(H,20,22) |
| InChIKey | AEAWMSBEJMDZIN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |