C26H30N2O4S — CID 2972348
N-[4-(3-ethoxypropylsulfamoyl)phenyl]-3,3-diphenylpropanamide (PubChem CID 2972348) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is N-[4-(3-ethoxypropylsulfamoyl)phenyl]-3,3-diphenylpropanamide.
| Compound Name | N-[4-(3-ethoxypropylsulfamoyl)phenyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 2972348 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-[4-(3-ethoxypropylsulfamoyl)phenyl]-3,3-diphenylpropanamide |
| SMILES | CCOCCCNS(=O)(=O)c1ccc(NC(=O)CC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H30N2O4S/c1-2-32-19-9-18-27-33(30,31)24-16-14-23(15-17-24)28-26(29)20-25(21-10-5-3-6-11-21)22-12-7-4-8-13-22/h3-8,10-17,25,27H,2,9,18-20H2,1H3,(H,28,29) |
| InChIKey | VJHBSRCBMSYSQN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|